C9H8F4N2O3 — CID 150990891
6-methyl-5-(2,2,3,3-tetrafluoropropoxy)pyrazine-2-carboxylic acid (PubChem CID 150990891) has the molecular formula C9H8F4N2O3 and a molecular weight of 268.17 g/mol. Its IUPAC name is 6-methyl-5-(2,2,3,3-tetrafluoropropoxy)pyrazine-2-carboxylic acid.
| Compound Name | 6-methyl-5-(2,2,3,3-tetrafluoropropoxy)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 150990891 |
| Molecular Formula | C9H8F4N2O3 |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 6-methyl-5-(2,2,3,3-tetrafluoropropoxy)pyrazine-2-carboxylic acid |
| SMILES | Cc1nc(C(=O)O)cnc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H8F4N2O3/c1-4-6(14-2-5(15-4)7(16)17)18-3-9(12,13)8(10)11/h2,8H,3H2,1H3,(H,16,17) |
| InChIKey | LSCCBNDMUGECTF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|