C12H14F4N2O3 — CID 103476099
4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxylic acid (PubChem CID 103476099) has the molecular formula C12H14F4N2O3 and a molecular weight of 310.25 g/mol. Its IUPAC name is 4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 103476099 |
| Molecular Formula | C12H14F4N2O3 |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxylic acid |
| SMILES | CCCc1nc(COCC(F)(F)C(F)F)ncc1C(=O)O |
| InChI | InChI=1S/C12H14F4N2O3/c1-2-3-8-7(10(19)20)4-17-9(18-8)5-21-6-12(15,16)11(13)14/h4,11H,2-3,5-6H2,1H3,(H,19,20) |
| InChIKey | GQXXIMLZVCTQPJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|