C11H12Cl2F4N2O — CID 103473554
4,6-dichloro-5-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine (PubChem CID 103473554) has the molecular formula C11H12Cl2F4N2O and a molecular weight of 335.13 g/mol. Its IUPAC name is 4,6-dichloro-5-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine.
| Compound Name | 4,6-dichloro-5-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 103473554 |
| Molecular Formula | C11H12Cl2F4N2O |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4,6-dichloro-5-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
| SMILES | CCCc1c(Cl)nc(COCC(F)(F)C(F)F)nc1Cl |
| InChI | InChI=1S/C11H12Cl2F4N2O/c1-2-3-6-8(12)18-7(19-9(6)13)4-20-5-11(16,17)10(14)15/h10H,2-5H2,1H3 |
| InChIKey | YNAFRQXXWDAYGL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|