C9H8ClF4IN2O — CID 103473568
4-chloro-5-iodo-6-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine (PubChem CID 103473568) has the molecular formula C9H8ClF4IN2O and a molecular weight of 398.53 g/mol. Its IUPAC name is 4-chloro-5-iodo-6-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine.
| Compound Name | 4-chloro-5-iodo-6-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 103473568 |
| Molecular Formula | C9H8ClF4IN2O |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 397.93 |
| IUPAC Name | 4-chloro-5-iodo-6-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
| SMILES | Cc1nc(COCC(F)(F)C(F)F)nc(Cl)c1I |
| InChI | InChI=1S/C9H8ClF4IN2O/c1-4-6(15)7(10)17-5(16-4)2-18-3-9(13,14)8(11)12/h8H,2-3H2,1H3 |
| InChIKey | YKSPHMGAOKILMO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|