C12H16F4IN3O — CID 103476348
5-iodo-6-(2-methylpropyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine (PubChem CID 103476348) has the molecular formula C12H16F4IN3O and a molecular weight of 421.18 g/mol. Its IUPAC name is 5-iodo-6-(2-methylpropyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine.
| Compound Name | 5-iodo-6-(2-methylpropyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103476348 |
| Molecular Formula | C12H16F4IN3O |
| Molecular Weight | 421.18 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 5-iodo-6-(2-methylpropyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine |
| SMILES | CC(C)Cc1nc(COCC(F)(F)C(F)F)nc(N)c1I |
| InChI | InChI=1S/C12H16F4IN3O/c1-6(2)3-7-9(17)10(18)20-8(19-7)4-21-5-12(15,16)11(13)14/h6,11H,3-5H2,1-2H3,(H2,18,19,20) |
| InChIKey | KIMHSSTXPIMRSM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|