C11H12F4IN3O — CID 103476333
6-cyclopropyl-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine (PubChem CID 103476333) has the molecular formula C11H12F4IN3O and a molecular weight of 405.13 g/mol. Its IUPAC name is 6-cyclopropyl-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103476333 |
| Molecular Formula | C11H12F4IN3O |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 6-cyclopropyl-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine |
| SMILES | Nc1nc(COCC(F)(F)C(F)F)nc(C2CC2)c1I |
| InChI | InChI=1S/C11H12F4IN3O/c12-10(13)11(14,15)4-20-3-6-18-8(5-1-2-5)7(16)9(17)19-6/h5,10H,1-4H2,(H2,17,18,19) |
| InChIKey | CFJHXZGMMOQNQQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|