C15H16IN3O — CID 66302352
6-cyclopropyl-5-iodo-2-[(4-methoxyphenyl)methyl]pyrimidin-4-amine (PubChem CID 66302352) has the molecular formula C15H16IN3O and a molecular weight of 381.22 g/mol. Its IUPAC name is 6-cyclopropyl-5-iodo-2-[(4-methoxyphenyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-5-iodo-2-[(4-methoxyphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66302352 |
| Molecular Formula | C15H16IN3O |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 6-cyclopropyl-5-iodo-2-[(4-methoxyphenyl)methyl]pyrimidin-4-amine |
| SMILES | COc1ccc(Cc2nc(N)c(I)c(C3CC3)n2)cc1 |
| InChI | InChI=1S/C15H16IN3O/c1-20-11-6-2-9(3-7-11)8-12-18-14(10-4-5-10)13(16)15(17)19-12/h2-3,6-7,10H,4-5,8H2,1H3,(H2,17,18,19) |
| InChIKey | QJJUCRBKFMUPGX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|