C15H14ClIN2O — CID 66292488
4-chloro-6-cyclopropyl-5-iodo-2-[(3-methoxyphenyl)methyl]pyrimidine (PubChem CID 66292488) has the molecular formula C15H14ClIN2O and a molecular weight of 400.65 g/mol. Its IUPAC name is 4-chloro-6-cyclopropyl-5-iodo-2-[(3-methoxyphenyl)methyl]pyrimidine.
| Compound Name | 4-chloro-6-cyclopropyl-5-iodo-2-[(3-methoxyphenyl)methyl]pyrimidine |
|---|---|
| PubChem CID | 66292488 |
| Molecular Formula | C15H14ClIN2O |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | 4-chloro-6-cyclopropyl-5-iodo-2-[(3-methoxyphenyl)methyl]pyrimidine |
| SMILES | COc1cccc(Cc2nc(Cl)c(I)c(C3CC3)n2)c1 |
| InChI | InChI=1S/C15H14ClIN2O/c1-20-11-4-2-3-9(7-11)8-12-18-14(10-5-6-10)13(17)15(16)19-12/h2-4,7,10H,5-6,8H2,1H3 |
| InChIKey | GYZGABIZBTXSMU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|