C15H16IN3O2 — CID 66312591
6-cyclopropyl-2-(2,5-dimethoxyphenyl)-5-iodopyrimidin-4-amine (PubChem CID 66312591) has the molecular formula C15H16IN3O2 and a molecular weight of 397.22 g/mol. Its IUPAC name is 6-cyclopropyl-2-(2,5-dimethoxyphenyl)-5-iodopyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-2-(2,5-dimethoxyphenyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66312591 |
| Molecular Formula | C15H16IN3O2 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 6-cyclopropyl-2-(2,5-dimethoxyphenyl)-5-iodopyrimidin-4-amine |
| SMILES | COc1ccc(OC)c(-c2nc(N)c(I)c(C3CC3)n2)c1 |
| InChI | InChI=1S/C15H16IN3O2/c1-20-9-5-6-11(21-2)10(7-9)15-18-13(8-3-4-8)12(16)14(17)19-15/h5-8H,3-4H2,1-2H3,(H2,17,18,19) |
| InChIKey | IYVHMWPZSAVQEK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|