C14H13FIN3 — CID 81277655
6-cyclopropyl-2-(4-fluoro-2-methylphenyl)-5-iodopyrimidin-4-amine (PubChem CID 81277655) has the molecular formula C14H13FIN3 and a molecular weight of 369.18 g/mol. Its IUPAC name is 6-cyclopropyl-2-(4-fluoro-2-methylphenyl)-5-iodopyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-2-(4-fluoro-2-methylphenyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 81277655 |
| Molecular Formula | C14H13FIN3 |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 6-cyclopropyl-2-(4-fluoro-2-methylphenyl)-5-iodopyrimidin-4-amine |
| SMILES | Cc1cc(F)ccc1-c1nc(N)c(I)c(C2CC2)n1 |
| InChI | InChI=1S/C14H13FIN3/c1-7-6-9(15)4-5-10(7)14-18-12(8-2-3-8)11(16)13(17)19-14/h4-6,8H,2-3H2,1H3,(H2,17,18,19) |
| InChIKey | IFSBYNPOOYKTFE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|