C13H18F4N2OS — CID 103476490
N-[[4-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]methyl]ethanamine (PubChem CID 103476490) has the molecular formula C13H18F4N2OS and a molecular weight of 326.36 g/mol. Its IUPAC name is N-[[4-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[4-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 103476490 |
| Molecular Formula | C13H18F4N2OS |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[[4-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1sc(COCC(F)(F)C(F)F)nc1C1CC1 |
| InChI | InChI=1S/C13H18F4N2OS/c1-2-18-5-9-11(8-3-4-8)19-10(21-9)6-20-7-13(16,17)12(14)15/h8,12,18H,2-7H2,1H3 |
| InChIKey | FQEJTNNILSWBEB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|