C12H18F2N2OS — CID 103150646
1-[4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]-N-methylmethanamine (PubChem CID 103150646) has the molecular formula C12H18F2N2OS and a molecular weight of 276.35 g/mol. Its IUPAC name is 1-[4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 103150646 |
| Molecular Formula | C12H18F2N2OS |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1sc(CCOCC(F)F)nc1C1CC1 |
| InChI | InChI=1S/C12H18F2N2OS/c1-15-6-9-12(8-2-3-8)16-11(18-9)4-5-17-7-10(13)14/h8,10,15H,2-7H2,1H3 |
| InChIKey | JZHTZDYGKVOBDG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|