C13H22F2N2OS — CID 103150626
N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,3-thiazol-5-yl]methyl]ethanamine (PubChem CID 103150626) has the molecular formula C13H22F2N2OS and a molecular weight of 292.39 g/mol. Its IUPAC name is N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,3-thiazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,3-thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 103150626 |
| Molecular Formula | C13H22F2N2OS |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,3-thiazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1sc(CCOCC(F)F)nc1C(C)C |
| InChI | InChI=1S/C13H22F2N2OS/c1-4-16-7-10-13(9(2)3)17-12(19-10)5-6-18-8-11(14)15/h9,11,16H,4-8H2,1-3H3 |
| InChIKey | LKGPZSSPHWBBSG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|