C14H24F2N2OS — CID 103150617
N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 103150617) has the molecular formula C14H24F2N2OS and a molecular weight of 306.42 g/mol. Its IUPAC name is N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103150617 |
| Molecular Formula | C14H24F2N2OS |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(CCOCC(F)F)nc1CCC |
| InChI | InChI=1S/C14H24F2N2OS/c1-3-5-11-12(9-17-7-4-2)20-14(18-11)6-8-19-10-13(15)16/h13,17H,3-10H2,1-2H3 |
| InChIKey | OJSVSQFRWVZJFO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|