C13H22F2N2O2S — CID 103150641
N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-(methoxymethyl)-1,3-thiazol-5-yl]methyl]propan-2-amine (PubChem CID 103150641) has the molecular formula C13H22F2N2O2S and a molecular weight of 308.39 g/mol. Its IUPAC name is N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-(methoxymethyl)-1,3-thiazol-5-yl]methyl]propan-2-amine.
| Compound Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-(methoxymethyl)-1,3-thiazol-5-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 103150641 |
| Molecular Formula | C13H22F2N2O2S |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-4-(methoxymethyl)-1,3-thiazol-5-yl]methyl]propan-2-amine |
| SMILES | COCc1nc(CCOCC(F)F)sc1CNC(C)C |
| InChI | InChI=1S/C13H22F2N2O2S/c1-9(2)16-6-11-10(7-18-3)17-13(20-11)4-5-19-8-12(14)15/h9,12,16H,4-8H2,1-3H3 |
| InChIKey | QBNHNBZCNKNYJU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|