C13H20F4N2OS — CID 103476460
1-[4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]-N-methylmethanamine (PubChem CID 103476460) has the molecular formula C13H20F4N2OS and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-[4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 103476460 |
| Molecular Formula | C13H20F4N2OS |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1sc(COCC(F)(F)C(F)F)nc1C(C)(C)C |
| InChI | InChI=1S/C13H20F4N2OS/c1-12(2,3)10-8(5-18-4)21-9(19-10)6-20-7-13(16,17)11(14)15/h11,18H,5-7H2,1-4H3 |
| InChIKey | GIDKYSBLMLTPOS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|