C10H12F4IN3O — CID 103476257
5-iodo-N,6-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine (PubChem CID 103476257) has the molecular formula C10H12F4IN3O and a molecular weight of 393.12 g/mol. Its IUPAC name is 5-iodo-N,6-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine.
| Compound Name | 5-iodo-N,6-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103476257 |
| Molecular Formula | C10H12F4IN3O |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 5-iodo-N,6-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-amine |
| SMILES | CNc1nc(COCC(F)(F)C(F)F)nc(C)c1I |
| InChI | InChI=1S/C10H12F4IN3O/c1-5-7(15)8(16-2)18-6(17-5)3-19-4-10(13,14)9(11)12/h9H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | JKXGVZQSSSZJDI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|