C11H15F3IN3O — CID 103476269
5-iodo-N-methyl-6-propyl-2-(2,2,2-trifluoroethoxymethyl)pyrimidin-4-amine (PubChem CID 103476269) has the molecular formula C11H15F3IN3O and a molecular weight of 389.16 g/mol. Its IUPAC name is 5-iodo-N-methyl-6-propyl-2-(2,2,2-trifluoroethoxymethyl)pyrimidin-4-amine.
| Compound Name | 5-iodo-N-methyl-6-propyl-2-(2,2,2-trifluoroethoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103476269 |
| Molecular Formula | C11H15F3IN3O |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 5-iodo-N-methyl-6-propyl-2-(2,2,2-trifluoroethoxymethyl)pyrimidin-4-amine |
| SMILES | CCCc1nc(COCC(F)(F)F)nc(NC)c1I |
| InChI | InChI=1S/C11H15F3IN3O/c1-3-4-7-9(15)10(16-2)18-8(17-7)5-19-6-11(12,13)14/h3-6H2,1-2H3,(H,16,17,18) |
| InChIKey | NZDRJUPDRNDTRK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|