C10H16BrN3O — CID 66307745
5-bromo-2-(methoxymethyl)-N-methyl-6-propylpyrimidin-4-amine (PubChem CID 66307745) has the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. Its IUPAC name is 5-bromo-2-(methoxymethyl)-N-methyl-6-propylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(methoxymethyl)-N-methyl-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66307745 |
| Molecular Formula | C10H16BrN3O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 5-bromo-2-(methoxymethyl)-N-methyl-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(COC)nc(NC)c1Br |
| InChI | InChI=1S/C10H16BrN3O/c1-4-5-7-9(11)10(12-2)14-8(13-7)6-15-3/h4-6H2,1-3H3,(H,12,13,14) |
| InChIKey | QVUBBSDSMTWYOV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |