C10H16BrN3 — CID 66306541
5-bromo-2-ethyl-N-methyl-6-propylpyrimidin-4-amine (PubChem CID 66306541) has the molecular formula C10H16BrN3 and a molecular weight of 258.16 g/mol. Its IUPAC name is 5-bromo-2-ethyl-N-methyl-6-propylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-ethyl-N-methyl-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66306541 |
| Molecular Formula | C10H16BrN3 |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-bromo-2-ethyl-N-methyl-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(CC)nc(NC)c1Br |
| InChI | InChI=1S/C10H16BrN3/c1-4-6-7-9(11)10(12-3)14-8(5-2)13-7/h4-6H2,1-3H3,(H,12,13,14) |
| InChIKey | MPRISYLPUMXJSE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |