C13H22IN3S — CID 66306382
2-(butan-2-ylsulfanylmethyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine (PubChem CID 66306382) has the molecular formula C13H22IN3S and a molecular weight of 379.31 g/mol. Its IUPAC name is 2-(butan-2-ylsulfanylmethyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine.
| Compound Name | 2-(butan-2-ylsulfanylmethyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66306382 |
| Molecular Formula | C13H22IN3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-(butan-2-ylsulfanylmethyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(CSC(C)CC)nc(NC)c1I |
| InChI | InChI=1S/C13H22IN3S/c1-5-7-10-12(14)13(15-4)17-11(16-10)8-18-9(3)6-2/h9H,5-8H2,1-4H3,(H,15,16,17) |
| InChIKey | QRAVFPVJGBLRPE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|