C17H22IN3 — CID 66305388
2-[(3,4-dimethylphenyl)methyl]-5-iodo-N-methyl-6-propylpyrimidin-4-amine (PubChem CID 66305388) has the molecular formula C17H22IN3 and a molecular weight of 395.29 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)methyl]-5-iodo-N-methyl-6-propylpyrimidin-4-amine.
| Compound Name | 2-[(3,4-dimethylphenyl)methyl]-5-iodo-N-methyl-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66305388 |
| Molecular Formula | C17H22IN3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)methyl]-5-iodo-N-methyl-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Cc2ccc(C)c(C)c2)nc(NC)c1I |
| InChI | InChI=1S/C17H22IN3/c1-5-6-14-16(18)17(19-4)21-15(20-14)10-13-8-7-11(2)12(3)9-13/h7-9H,5-6,10H2,1-4H3,(H,19,20,21) |
| InChIKey | NDGQTVZZFTWWLF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|