C14H15ClIN3 — CID 66305986
2-(4-chlorophenyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine (PubChem CID 66305986) has the molecular formula C14H15ClIN3 and a molecular weight of 387.65 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine.
| Compound Name | 2-(4-chlorophenyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66305986 |
| Molecular Formula | C14H15ClIN3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 2-(4-chlorophenyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(-c2ccc(Cl)cc2)nc(NC)c1I |
| InChI | InChI=1S/C14H15ClIN3/c1-3-4-11-12(16)14(17-2)19-13(18-11)9-5-7-10(15)8-6-9/h5-8H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | JUANFMQNTCVEGA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|