C14H14BrFIN3 — CID 107924001
2-(2-bromo-5-fluorophenyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine (PubChem CID 107924001) has the molecular formula C14H14BrFIN3 and a molecular weight of 450.09 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107924001 |
| Molecular Formula | C14H14BrFIN3 |
| Molecular Weight | 450.09 g/mol |
| Exact Mass | 448.94 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-5-iodo-N-methyl-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(-c2cc(F)ccc2Br)nc(NC)c1I |
| InChI | InChI=1S/C14H14BrFIN3/c1-3-4-11-12(17)14(18-2)20-13(19-11)9-7-8(16)5-6-10(9)15/h5-7H,3-4H2,1-2H3,(H,18,19,20) |
| InChIKey | ZTYACIAEUHOZOU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.09 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|