C15H16BrFIN3 — CID 107924043
2-(2-bromo-5-fluorophenyl)-5-iodo-N-methyl-6-(2-methylpropyl)pyrimidin-4-amine (PubChem CID 107924043) has the molecular formula C15H16BrFIN3 and a molecular weight of 464.12 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-5-iodo-N-methyl-6-(2-methylpropyl)pyrimidin-4-amine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-5-iodo-N-methyl-6-(2-methylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107924043 |
| Molecular Formula | C15H16BrFIN3 |
| Molecular Weight | 464.12 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-5-iodo-N-methyl-6-(2-methylpropyl)pyrimidin-4-amine |
| SMILES | CNc1nc(-c2cc(F)ccc2Br)nc(CC(C)C)c1I |
| InChI | InChI=1S/C15H16BrFIN3/c1-8(2)6-12-13(18)15(19-3)21-14(20-12)10-7-9(17)4-5-11(10)16/h4-5,7-8H,6H2,1-3H3,(H,19,20,21) |
| InChIKey | KJLAAWCTKFJKDY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.12 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|