C16H20IN3 — CID 66306395
2-benzyl-N-ethyl-5-iodo-6-propylpyrimidin-4-amine (PubChem CID 66306395) has the molecular formula C16H20IN3 and a molecular weight of 381.26 g/mol. Its IUPAC name is 2-benzyl-N-ethyl-5-iodo-6-propylpyrimidin-4-amine.
| Compound Name | 2-benzyl-N-ethyl-5-iodo-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66306395 |
| Molecular Formula | C16H20IN3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2-benzyl-N-ethyl-5-iodo-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Cc2ccccc2)nc(NCC)c1I |
| InChI | InChI=1S/C16H20IN3/c1-3-8-13-15(17)16(18-4-2)20-14(19-13)11-12-9-6-5-7-10-12/h5-7,9-10H,3-4,8,11H2,1-2H3,(H,18,19,20) |
| InChIKey | CUYDKHUXNPOMOL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|