C14H17IN4 — CID 66299480
N,6-diethyl-5-iodo-2-(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 66299480) has the molecular formula C14H17IN4 and a molecular weight of 368.22 g/mol. Its IUPAC name is N,6-diethyl-5-iodo-2-(pyridin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | N,6-diethyl-5-iodo-2-(pyridin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66299480 |
| Molecular Formula | C14H17IN4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N,6-diethyl-5-iodo-2-(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(Cc2cccnc2)nc(CC)c1I |
| InChI | InChI=1S/C14H17IN4/c1-3-11-13(15)14(17-4-2)19-12(18-11)8-10-6-5-7-16-9-10/h5-7,9H,3-4,8H2,1-2H3,(H,17,18,19) |
| InChIKey | NJXWFJVJPYEBMZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|