C13H22IN3 — CID 66299095
2-(2,2-dimethylpropyl)-N,6-diethyl-5-iodopyrimidin-4-amine (PubChem CID 66299095) has the molecular formula C13H22IN3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-N,6-diethyl-5-iodopyrimidin-4-amine.
| Compound Name | 2-(2,2-dimethylpropyl)-N,6-diethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66299095 |
| Molecular Formula | C13H22IN3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-N,6-diethyl-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(CC(C)(C)C)nc(CC)c1I |
| InChI | InChI=1S/C13H22IN3/c1-6-9-11(14)12(15-7-2)17-10(16-9)8-13(3,4)5/h6-8H2,1-5H3,(H,15,16,17) |
| InChIKey | ZQSSRZWGNUKNDP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|