C15H26IN3 — CID 66298625
6-tert-butyl-2-(2,2-dimethylpropyl)-N-ethyl-5-iodopyrimidin-4-amine (PubChem CID 66298625) has the molecular formula C15H26IN3 and a molecular weight of 375.30 g/mol. Its IUPAC name is 6-tert-butyl-2-(2,2-dimethylpropyl)-N-ethyl-5-iodopyrimidin-4-amine.
| Compound Name | 6-tert-butyl-2-(2,2-dimethylpropyl)-N-ethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66298625 |
| Molecular Formula | C15H26IN3 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 6-tert-butyl-2-(2,2-dimethylpropyl)-N-ethyl-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(CC(C)(C)C)nc(C(C)(C)C)c1I |
| InChI | InChI=1S/C15H26IN3/c1-8-17-13-11(16)12(15(5,6)7)18-10(19-13)9-14(2,3)4/h8-9H2,1-7H3,(H,17,18,19) |
| InChIKey | NMYJMIBSMIRETP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|