C14H24IN3 — CID 66299026
6-tert-butyl-5-iodo-N,2-dipropylpyrimidin-4-amine (PubChem CID 66299026) has the molecular formula C14H24IN3 and a molecular weight of 361.27 g/mol. Its IUPAC name is 6-tert-butyl-5-iodo-N,2-dipropylpyrimidin-4-amine.
| Compound Name | 6-tert-butyl-5-iodo-N,2-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299026 |
| Molecular Formula | C14H24IN3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 6-tert-butyl-5-iodo-N,2-dipropylpyrimidin-4-amine |
| SMILES | CCCNc1nc(CCC)nc(C(C)(C)C)c1I |
| InChI | InChI=1S/C14H24IN3/c1-6-8-10-17-12(14(3,4)5)11(15)13(18-10)16-9-7-2/h6-9H2,1-5H3,(H,16,17,18) |
| InChIKey | ZJCMMMGDBKQFNF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|