C11H18IN3 — CID 66299608
6-tert-butyl-N-ethyl-5-iodo-2-methylpyrimidin-4-amine (PubChem CID 66299608) has the molecular formula C11H18IN3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 6-tert-butyl-N-ethyl-5-iodo-2-methylpyrimidin-4-amine.
| Compound Name | 6-tert-butyl-N-ethyl-5-iodo-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299608 |
| Molecular Formula | C11H18IN3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 6-tert-butyl-N-ethyl-5-iodo-2-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(C)nc(C(C)(C)C)c1I |
| InChI | InChI=1S/C11H18IN3/c1-6-13-10-8(12)9(11(3,4)5)14-7(2)15-10/h6H2,1-5H3,(H,13,14,15) |
| InChIKey | YJXLMMKYCFYMJU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|