C16H19BrIN3 — CID 66299806
2-(2-bromophenyl)-6-tert-butyl-N-ethyl-5-iodopyrimidin-4-amine (PubChem CID 66299806) has the molecular formula C16H19BrIN3 and a molecular weight of 460.16 g/mol. Its IUPAC name is 2-(2-bromophenyl)-6-tert-butyl-N-ethyl-5-iodopyrimidin-4-amine.
| Compound Name | 2-(2-bromophenyl)-6-tert-butyl-N-ethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66299806 |
| Molecular Formula | C16H19BrIN3 |
| Molecular Weight | 460.16 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | 2-(2-bromophenyl)-6-tert-butyl-N-ethyl-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(-c2ccccc2Br)nc(C(C)(C)C)c1I |
| InChI | InChI=1S/C16H19BrIN3/c1-5-19-15-12(18)13(16(2,3)4)20-14(21-15)10-8-6-7-9-11(10)17/h6-9H,5H2,1-4H3,(H,19,20,21) |
| InChIKey | ABRSVDSHHYGRLY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.16 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|