C15H20IN3O — CID 104806799
6-tert-butyl-N-ethyl-5-iodo-2-(3-methylfuran-2-yl)pyrimidin-4-amine (PubChem CID 104806799) has the molecular formula C15H20IN3O and a molecular weight of 385.25 g/mol. Its IUPAC name is 6-tert-butyl-N-ethyl-5-iodo-2-(3-methylfuran-2-yl)pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-N-ethyl-5-iodo-2-(3-methylfuran-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 104806799 |
| Molecular Formula | C15H20IN3O |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 6-tert-butyl-N-ethyl-5-iodo-2-(3-methylfuran-2-yl)pyrimidin-4-amine |
| SMILES | CCNc1nc(-c2occc2C)nc(C(C)(C)C)c1I |
| InChI | InChI=1S/C15H20IN3O/c1-6-17-13-10(16)12(15(3,4)5)18-14(19-13)11-9(2)7-8-20-11/h7-8H,6H2,1-5H3,(H,17,18,19) |
| InChIKey | SQYZJARPFSZDIP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|