C15H20IN3O — CID 104806784
5-iodo-2-(3-methylfuran-2-yl)-N,6-dipropylpyrimidin-4-amine (PubChem CID 104806784) has the molecular formula C15H20IN3O and a molecular weight of 385.25 g/mol. Its IUPAC name is 5-iodo-2-(3-methylfuran-2-yl)-N,6-dipropylpyrimidin-4-amine.
| Compound Name | 5-iodo-2-(3-methylfuran-2-yl)-N,6-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 104806784 |
| Molecular Formula | C15H20IN3O |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 5-iodo-2-(3-methylfuran-2-yl)-N,6-dipropylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2occc2C)nc(CCC)c1I |
| InChI | InChI=1S/C15H20IN3O/c1-4-6-11-12(16)14(17-8-5-2)19-15(18-11)13-10(3)7-9-20-13/h7,9H,4-6,8H2,1-3H3,(H,17,18,19) |
| InChIKey | DXJXDEQCJMOSBL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|