C14H24IN3 — CID 66299999
2,6-ditert-butyl-N-ethyl-5-iodopyrimidin-4-amine (PubChem CID 66299999) has the molecular formula C14H24IN3 and a molecular weight of 361.27 g/mol. Its IUPAC name is 2,6-ditert-butyl-N-ethyl-5-iodopyrimidin-4-amine.
| Compound Name | 2,6-ditert-butyl-N-ethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66299999 |
| Molecular Formula | C14H24IN3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2,6-ditert-butyl-N-ethyl-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(C(C)(C)C)nc(C(C)(C)C)c1I |
| InChI | InChI=1S/C14H24IN3/c1-8-16-11-9(15)10(13(2,3)4)17-12(18-11)14(5,6)7/h8H2,1-7H3,(H,16,17,18) |
| InChIKey | CSMWVYBGSAWXRR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|