C14H24BrN3 — CID 66307012
5-bromo-2,6-ditert-butyl-N-ethylpyrimidin-4-amine (PubChem CID 66307012) has the molecular formula C14H24BrN3 and a molecular weight of 314.27 g/mol. Its IUPAC name is 5-bromo-2,6-ditert-butyl-N-ethylpyrimidin-4-amine.
| Compound Name | 5-bromo-2,6-ditert-butyl-N-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66307012 |
| Molecular Formula | C14H24BrN3 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 5-bromo-2,6-ditert-butyl-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1nc(C(C)(C)C)nc(C(C)(C)C)c1Br |
| InChI | InChI=1S/C14H24BrN3/c1-8-16-11-9(15)10(13(2,3)4)17-12(18-11)14(5,6)7/h8H2,1-7H3,(H,16,17,18) |
| InChIKey | RHAGRBWGQIEVTJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |