C17H28IN3 — CID 66300395
6-tert-butyl-N-ethyl-2-(3-ethylcyclopentyl)-5-iodopyrimidin-4-amine (PubChem CID 66300395) has the molecular formula C17H28IN3 and a molecular weight of 401.34 g/mol. Its IUPAC name is 6-tert-butyl-N-ethyl-2-(3-ethylcyclopentyl)-5-iodopyrimidin-4-amine.
| Compound Name | 6-tert-butyl-N-ethyl-2-(3-ethylcyclopentyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66300395 |
| Molecular Formula | C17H28IN3 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 6-tert-butyl-N-ethyl-2-(3-ethylcyclopentyl)-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(C2CCC(CC)C2)nc(C(C)(C)C)c1I |
| InChI | InChI=1S/C17H28IN3/c1-6-11-8-9-12(10-11)15-20-14(17(3,4)5)13(18)16(21-15)19-7-2/h11-12H,6-10H2,1-5H3,(H,19,20,21) |
| InChIKey | QMGCRLFUQRWOMX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|