C15H17ClIN3 — CID 66300863
2-[(4-chlorophenyl)methyl]-N,6-diethyl-5-iodopyrimidin-4-amine (PubChem CID 66300863) has the molecular formula C15H17ClIN3 and a molecular weight of 401.68 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-N,6-diethyl-5-iodopyrimidin-4-amine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-N,6-diethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66300863 |
| Molecular Formula | C15H17ClIN3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-N,6-diethyl-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(Cc2ccc(Cl)cc2)nc(CC)c1I |
| InChI | InChI=1S/C15H17ClIN3/c1-3-12-14(17)15(18-4-2)20-13(19-12)9-10-5-7-11(16)8-6-10/h5-8H,3-4,9H2,1-2H3,(H,18,19,20) |
| InChIKey | JUJLIJVVWKFZIP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|