C16H19ClIN3 — CID 66299752
2-[(3-chlorophenyl)methyl]-N-ethyl-5-iodo-6-propan-2-ylpyrimidin-4-amine (PubChem CID 66299752) has the molecular formula C16H19ClIN3 and a molecular weight of 415.71 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-N-ethyl-5-iodo-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-[(3-chlorophenyl)methyl]-N-ethyl-5-iodo-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299752 |
| Molecular Formula | C16H19ClIN3 |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-N-ethyl-5-iodo-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CCNc1nc(Cc2cccc(Cl)c2)nc(C(C)C)c1I |
| InChI | InChI=1S/C16H19ClIN3/c1-4-19-16-14(18)15(10(2)3)20-13(21-16)9-11-6-5-7-12(17)8-11/h5-8,10H,4,9H2,1-3H3,(H,19,20,21) |
| InChIKey | RNNVCSNUTQTKJE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|