C15H16ClFIN3 — CID 82790667
2-[(3-chloro-2-fluorophenyl)methyl]-5-iodo-N-methyl-6-propan-2-ylpyrimidin-4-amine (PubChem CID 82790667) has the molecular formula C15H16ClFIN3 and a molecular weight of 419.67 g/mol. Its IUPAC name is 2-[(3-chloro-2-fluorophenyl)methyl]-5-iodo-N-methyl-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-[(3-chloro-2-fluorophenyl)methyl]-5-iodo-N-methyl-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82790667 |
| Molecular Formula | C15H16ClFIN3 |
| Molecular Weight | 419.67 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 2-[(3-chloro-2-fluorophenyl)methyl]-5-iodo-N-methyl-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CNc1nc(Cc2cccc(Cl)c2F)nc(C(C)C)c1I |
| InChI | InChI=1S/C15H16ClFIN3/c1-8(2)14-13(18)15(19-3)21-11(20-14)7-9-5-4-6-10(16)12(9)17/h4-6,8H,7H2,1-3H3,(H,19,20,21) |
| InChIKey | XHQAANZTUVAQKO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.67 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|