C13H13ClIN3 — CID 66307698
2-[(2-chlorophenyl)methyl]-5-iodo-N,6-dimethylpyrimidin-4-amine (PubChem CID 66307698) has the molecular formula C13H13ClIN3 and a molecular weight of 373.63 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-5-iodo-N,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-[(2-chlorophenyl)methyl]-5-iodo-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66307698 |
| Molecular Formula | C13H13ClIN3 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-5-iodo-N,6-dimethylpyrimidin-4-amine |
| SMILES | CNc1nc(Cc2ccccc2Cl)nc(C)c1I |
| InChI | InChI=1S/C13H13ClIN3/c1-8-12(15)13(16-2)18-11(17-8)7-9-5-3-4-6-10(9)14/h3-6H,7H2,1-2H3,(H,16,17,18) |
| InChIKey | QTEBRKAFSPGMPK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|