C13H13BrIN3S — CID 66307296
2-[(2-bromophenyl)sulfanylmethyl]-5-iodo-N,6-dimethylpyrimidin-4-amine (PubChem CID 66307296) has the molecular formula C13H13BrIN3S and a molecular weight of 450.14 g/mol. Its IUPAC name is 2-[(2-bromophenyl)sulfanylmethyl]-5-iodo-N,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-[(2-bromophenyl)sulfanylmethyl]-5-iodo-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66307296 |
| Molecular Formula | C13H13BrIN3S |
| Molecular Weight | 450.14 g/mol |
| Exact Mass | 448.91 |
| IUPAC Name | 2-[(2-bromophenyl)sulfanylmethyl]-5-iodo-N,6-dimethylpyrimidin-4-amine |
| SMILES | CNc1nc(CSc2ccccc2Br)nc(C)c1I |
| InChI | InChI=1S/C13H13BrIN3S/c1-8-12(15)13(16-2)18-11(17-8)7-19-10-6-4-3-5-9(10)14/h3-6H,7H2,1-2H3,(H,16,17,18) |
| InChIKey | OLEVVDCOYRCUDB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.14 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|