C17H15BrN2S — CID 63487095
3-[(2-bromophenyl)sulfanylmethyl]-N-methylquinolin-2-amine (PubChem CID 63487095) has the molecular formula C17H15BrN2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 3-[(2-bromophenyl)sulfanylmethyl]-N-methylquinolin-2-amine.
| Compound Name | 3-[(2-bromophenyl)sulfanylmethyl]-N-methylquinolin-2-amine |
|---|---|
| PubChem CID | 63487095 |
| Molecular Formula | C17H15BrN2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 3-[(2-bromophenyl)sulfanylmethyl]-N-methylquinolin-2-amine |
| SMILES | CNc1nc2ccccc2cc1CSc1ccccc1Br |
| InChI | InChI=1S/C17H15BrN2S/c1-19-17-13(10-12-6-2-4-8-15(12)20-17)11-21-16-9-5-3-7-14(16)18/h2-10H,11H2,1H3,(H,19,20) |
| InChIKey | HDUYPZQPWLRWGE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |