C15H15ClIN3 — CID 66302364
2-[(3-chlorophenyl)methyl]-6-cyclopropyl-5-iodo-N-methylpyrimidin-4-amine (PubChem CID 66302364) has the molecular formula C15H15ClIN3 and a molecular weight of 399.66 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-6-cyclopropyl-5-iodo-N-methylpyrimidin-4-amine.
| Compound Name | 2-[(3-chlorophenyl)methyl]-6-cyclopropyl-5-iodo-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66302364 |
| Molecular Formula | C15H15ClIN3 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-6-cyclopropyl-5-iodo-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(Cc2cccc(Cl)c2)nc(C2CC2)c1I |
| InChI | InChI=1S/C15H15ClIN3/c1-18-15-13(17)14(10-5-6-10)19-12(20-15)8-9-3-2-4-11(16)7-9/h2-4,7,10H,5-6,8H2,1H3,(H,18,19,20) |
| InChIKey | WUWNBJONZVXDRL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|