C12H20IN3 — CID 66299485
N,6-diethyl-5-iodo-2-(2-methylpropyl)pyrimidin-4-amine (PubChem CID 66299485) has the molecular formula C12H20IN3 and a molecular weight of 333.22 g/mol. Its IUPAC name is N,6-diethyl-5-iodo-2-(2-methylpropyl)pyrimidin-4-amine.
| Compound Name | N,6-diethyl-5-iodo-2-(2-methylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66299485 |
| Molecular Formula | C12H20IN3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N,6-diethyl-5-iodo-2-(2-methylpropyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(CC(C)C)nc(CC)c1I |
| InChI | InChI=1S/C12H20IN3/c1-5-9-11(13)12(14-6-2)16-10(15-9)7-8(3)4/h8H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | GGUCSEPZUAXMPD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|