C13H15IN4 — CID 66299682
N,6-diethyl-5-iodo-2-pyridin-3-ylpyrimidin-4-amine (PubChem CID 66299682) has the molecular formula C13H15IN4 and a molecular weight of 354.20 g/mol. Its IUPAC name is N,6-diethyl-5-iodo-2-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | N,6-diethyl-5-iodo-2-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299682 |
| Molecular Formula | C13H15IN4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | N,6-diethyl-5-iodo-2-pyridin-3-ylpyrimidin-4-amine |
| SMILES | CCNc1nc(-c2cccnc2)nc(CC)c1I |
| InChI | InChI=1S/C13H15IN4/c1-3-10-11(14)13(16-4-2)18-12(17-10)9-6-5-7-15-8-9/h5-8H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | WQIUVESOIAWQMI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|