C15H17FIN3O — CID 66297351
N,6-diethyl-2-(3-fluoro-4-methoxyphenyl)-5-iodopyrimidin-4-amine (PubChem CID 66297351) has the molecular formula C15H17FIN3O and a molecular weight of 401.22 g/mol. Its IUPAC name is N,6-diethyl-2-(3-fluoro-4-methoxyphenyl)-5-iodopyrimidin-4-amine.
| Compound Name | N,6-diethyl-2-(3-fluoro-4-methoxyphenyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66297351 |
| Molecular Formula | C15H17FIN3O |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | N,6-diethyl-2-(3-fluoro-4-methoxyphenyl)-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(-c2ccc(OC)c(F)c2)nc(CC)c1I |
| InChI | InChI=1S/C15H17FIN3O/c1-4-11-13(17)15(18-5-2)20-14(19-11)9-6-7-12(21-3)10(16)8-9/h6-8H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | RYARJKQZTLQLNT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|