C11H12FN3O — CID 62920233
5-ethyl-3-(3-fluoro-4-methoxyphenyl)-1H-1,2,4-triazole (PubChem CID 62920233) has the molecular formula C11H12FN3O and a molecular weight of 221.24 g/mol. Its IUPAC name is 5-ethyl-3-(3-fluoro-4-methoxyphenyl)-1H-1,2,4-triazole.
| Compound Name | 5-ethyl-3-(3-fluoro-4-methoxyphenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 62920233 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-ethyl-3-(3-fluoro-4-methoxyphenyl)-1H-1,2,4-triazole |
| SMILES | CCc1nc(-c2ccc(OC)c(F)c2)n[nH]1 |
| InChI | InChI=1S/C11H12FN3O/c1-3-10-13-11(15-14-10)7-4-5-9(16-2)8(12)6-7/h4-6H,3H2,1-2H3,(H,13,14,15) |
| InChIKey | WNJWWZJBIPGDOJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |