C9H6ClF2N3 — CID 79599919
5-(chloromethyl)-3-(3,4-difluorophenyl)-1H-1,2,4-triazole (PubChem CID 79599919) has the molecular formula C9H6ClF2N3 and a molecular weight of 229.62 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(3,4-difluorophenyl)-1H-1,2,4-triazole.
| Compound Name | 5-(chloromethyl)-3-(3,4-difluorophenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 79599919 |
| Molecular Formula | C9H6ClF2N3 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 5-(chloromethyl)-3-(3,4-difluorophenyl)-1H-1,2,4-triazole |
| SMILES | Fc1ccc(-c2n[nH]c(CCl)n2)cc1F |
| InChI | InChI=1S/C9H6ClF2N3/c10-4-8-13-9(15-14-8)5-1-2-6(11)7(12)3-5/h1-3H,4H2,(H,13,14,15) |
| InChIKey | KJLPRHAFUGJWMU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|