C15H17FIN3 — CID 66298313
N,6-diethyl-2-(5-fluoro-2-methylphenyl)-5-iodopyrimidin-4-amine (PubChem CID 66298313) has the molecular formula C15H17FIN3 and a molecular weight of 385.22 g/mol. Its IUPAC name is N,6-diethyl-2-(5-fluoro-2-methylphenyl)-5-iodopyrimidin-4-amine.
| Compound Name | N,6-diethyl-2-(5-fluoro-2-methylphenyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66298313 |
| Molecular Formula | C15H17FIN3 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | N,6-diethyl-2-(5-fluoro-2-methylphenyl)-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(-c2cc(F)ccc2C)nc(CC)c1I |
| InChI | InChI=1S/C15H17FIN3/c1-4-12-13(17)15(18-5-2)20-14(19-12)11-8-10(16)7-6-9(11)3/h6-8H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | JOUWVSXIPBICLA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|